C13H17N5 — CID 110029530
1-cyclopropyl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)-1-methylguanidine (PubChem CID 110029530) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)-1-methylguanidine |
|---|---|
| PubChem CID | 110029530 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 1-cyclopropyl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)-1-methylguanidine |
| SMILES | CN(/C(N)=N/Cc1cn2ccccc2n1)C1CC1 |
| InChI | InChI=1S/C13H17N5/c1-17(11-5-6-11)13(14)15-8-10-9-18-7-3-2-4-12(18)16-10/h2-4,7,9,11H,5-6,8H2,1H3,(H2,14,15) |
| InChIKey | YGOQXXZJPCKAAM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|