C13H19N5 — CID 110919308
1-butan-2-yl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)guanidine (PubChem CID 110919308) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-butan-2-yl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-butan-2-yl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110919308 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 1-butan-2-yl-2-(imidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
| SMILES | CCC(C)N/C(N)=N/Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C13H19N5/c1-3-10(2)16-13(14)15-8-11-9-18-7-5-4-6-12(18)17-11/h4-7,9-10H,3,8H2,1-2H3,(H3,14,15,16) |
| InChIKey | PGGNLRJPWLGUBZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|