C12H17BrIN5 — CID 111075326
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide (PubChem CID 111075326) has the molecular formula C12H17BrIN5 and a molecular weight of 438.11 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111075326 |
| Molecular Formula | C12H17BrIN5 |
| Molecular Weight | 438.11 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/Cc1cn2cc(Br)ccc2n1.I |
| InChI | InChI=1S/C12H16BrN5.HI/c1-8(2)16-12(14)15-5-10-7-18-6-9(13)3-4-11(18)17-10;/h3-4,6-8H,5H2,1-2H3,(H3,14,15,16);1H |
| InChIKey | JDDYOTKRGKFYDK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.11 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|