C15H15BrIN5 — CID 110917941
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110917941) has the molecular formula C15H15BrIN5 and a molecular weight of 472.13 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110917941 |
| Molecular Formula | C15H15BrIN5 |
| Molecular Weight | 472.13 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cn2cc(Br)ccc2n1)Nc1ccccc1 |
| InChI | InChI=1S/C15H14BrN5.HI/c16-11-6-7-14-19-13(10-21(14)9-11)8-18-15(17)20-12-4-2-1-3-5-12;/h1-7,9-10H,8H2,(H3,17,18,20);1H |
| InChIKey | WKXUCSAJYIOLIR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|