C18H21N5 — CID 111809778
1-(3,5-dimethylphenyl)-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine (PubChem CID 111809778) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111809778 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2cn3c(C)cccc3n2)c1 |
| InChI | InChI=1S/C18H21N5/c1-12-7-13(2)9-15(8-12)22-18(19)20-10-16-11-23-14(3)5-4-6-17(23)21-16/h4-9,11H,10H2,1-3H3,(H3,19,20,22) |
| InChIKey | QSMUIDJHHFZMEB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|