C15H10N2 — CID 161185630
2-(2-phenylethynyl)imidazo[1,2-a]pyridine (PubChem CID 161185630) has the molecular formula C15H10N2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(2-phenylethynyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(2-phenylethynyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 161185630 |
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-(2-phenylethynyl)imidazo[1,2-a]pyridine |
| SMILES | C(#Cc1cn2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C15H10N2/c1-2-6-13(7-3-1)9-10-14-12-17-11-5-4-8-15(17)16-14/h1-8,11-12H |
| InChIKey | UTAVGYGULSSWLU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|