C8H9N3S — CID 147221875
N-methylsulfanylimidazo[1,2-a]pyridin-2-amine (PubChem CID 147221875) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is N-methylsulfanylimidazo[1,2-a]pyridin-2-amine.
| Compound Name | N-methylsulfanylimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 147221875 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | N-methylsulfanylimidazo[1,2-a]pyridin-2-amine |
| SMILES | CSNc1cn2ccccc2n1 |
| InChI | InChI=1S/C8H9N3S/c1-12-10-7-6-11-5-3-2-4-8(11)9-7/h2-6,10H,1H3 |
| InChIKey | CHFQODVYLFIOHQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|