C9H13Cl2N3 — CID 155970924
(1S)-1-imidazo[1,2-a]pyridin-2-ylethanamine;dihydrochloride (PubChem CID 155970924) has the molecular formula C9H13Cl2N3 and a molecular weight of 234.13 g/mol. Its IUPAC name is (1S)-1-imidazo[1,2-a]pyridin-2-ylethanamine;dihydrochloride.
| Compound Name | (1S)-1-imidazo[1,2-a]pyridin-2-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 155970924 |
| Molecular Formula | C9H13Cl2N3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | (1S)-1-imidazo[1,2-a]pyridin-2-ylethanamine;dihydrochloride |
| SMILES | C[C@H](N)c1cn2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C9H11N3.2ClH/c1-7(10)8-6-12-5-3-2-4-9(12)11-8;;/h2-7H,10H2,1H3;2*1H/t7-;;/m0../s1 |
| InChIKey | ZIRCCCYAELHTMM-KLXURFKVSA-N |
| XLogP | 2.20 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |