C10H10N2O3 — CID 70818317
methyl 2-hydroxy-2-imidazo[1,2-a]pyridin-2-ylacetate (PubChem CID 70818317) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 2-hydroxy-2-imidazo[1,2-a]pyridin-2-ylacetate.
| Compound Name | methyl 2-hydroxy-2-imidazo[1,2-a]pyridin-2-ylacetate |
|---|---|
| PubChem CID | 70818317 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl 2-hydroxy-2-imidazo[1,2-a]pyridin-2-ylacetate |
| SMILES | COC(=O)C(O)c1cn2ccccc2n1 |
| InChI | InChI=1S/C10H10N2O3/c1-15-10(14)9(13)7-6-12-5-3-2-4-8(12)11-7/h2-6,9,13H,1H3 |
| InChIKey | YNKISNLLEQTVAN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |