C19H17BrN2 — CID 11681875
3-bromo-6-(1,2-diphenylethyl)pyridin-2-amine (PubChem CID 11681875) has the molecular formula C19H17BrN2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 3-bromo-6-(1,2-diphenylethyl)pyridin-2-amine.
| Compound Name | 3-bromo-6-(1,2-diphenylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 11681875 |
| Molecular Formula | C19H17BrN2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-bromo-6-(1,2-diphenylethyl)pyridin-2-amine |
| SMILES | Nc1nc(C(Cc2ccccc2)c2ccccc2)ccc1Br |
| InChI | InChI=1S/C19H17BrN2/c20-17-11-12-18(22-19(17)21)16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-12,16H,13H2,(H2,21,22) |
| InChIKey | RPUWFHNWBKOMEM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |