C13H18N2O3 — CID 116819357
(2-methoxyphenyl) 3-aminopiperidine-1-carboxylate (PubChem CID 116819357) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2-methoxyphenyl) 3-aminopiperidine-1-carboxylate.
| Compound Name | (2-methoxyphenyl) 3-aminopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 116819357 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (2-methoxyphenyl) 3-aminopiperidine-1-carboxylate |
| SMILES | COc1ccccc1OC(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C13H18N2O3/c1-17-11-6-2-3-7-12(11)18-13(16)15-8-4-5-10(14)9-15/h2-3,6-7,10H,4-5,8-9,14H2,1H3 |
| InChIKey | LAOPGVYZTAMKID-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |