C14H20N2O3 — CID 116819379
(2-methoxy-4-methylphenyl) 3-aminopiperidine-1-carboxylate (PubChem CID 116819379) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2-methoxy-4-methylphenyl) 3-aminopiperidine-1-carboxylate.
| Compound Name | (2-methoxy-4-methylphenyl) 3-aminopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 116819379 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2-methoxy-4-methylphenyl) 3-aminopiperidine-1-carboxylate |
| SMILES | COc1cc(C)ccc1OC(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C14H20N2O3/c1-10-5-6-12(13(8-10)18-2)19-14(17)16-7-3-4-11(15)9-16/h5-6,8,11H,3-4,7,9,15H2,1-2H3 |
| InChIKey | VSBHTKWIDQVWHX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |