C14H15ClO3 — CID 116822547
(2E,4E)-5-(5-chloro-2-methoxy-3-methylphenyl)hexa-2,4-dienoic acid (PubChem CID 116822547) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is (2E,4E)-5-(5-chloro-2-methoxy-3-methylphenyl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(5-chloro-2-methoxy-3-methylphenyl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822547 |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (2E,4E)-5-(5-chloro-2-methoxy-3-methylphenyl)hexa-2,4-dienoic acid |
| SMILES | COc1c(C)cc(Cl)cc1/C(C)=C/C=C/C(=O)O |
| InChI | InChI=1S/C14H15ClO3/c1-9(5-4-6-13(16)17)12-8-11(15)7-10(2)14(12)18-3/h4-8H,1-3H3,(H,16,17)/b6-4+,9-5+ |
| InChIKey | XRZKRZIJXQZGML-REZHQCRGSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|