C14H17ClO3 — CID 116822637
3-chloro-1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)propane-1,2-dione (PubChem CID 116822637) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is 3-chloro-1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)propane-1,2-dione.
| Compound Name | 3-chloro-1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 116822637 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-chloro-1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)propane-1,2-dione |
| SMILES | COc1cc(C)c(C(=O)C(=O)CCl)cc1C(C)C |
| InChI | InChI=1S/C14H17ClO3/c1-8(2)10-6-11(14(17)12(16)7-15)9(3)5-13(10)18-4/h5-6,8H,7H2,1-4H3 |
| InChIKey | HXRTZGCBOWTLOS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|