C7H10N4 — CID 116823105
6-cyclobutyl-1,2,4-triazin-5-amine (PubChem CID 116823105) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 6-cyclobutyl-1,2,4-triazin-5-amine.
| Compound Name | 6-cyclobutyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823105 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 6-cyclobutyl-1,2,4-triazin-5-amine |
| SMILES | Nc1ncnnc1C1CCC1 |
| InChI | InChI=1S/C7H10N4/c8-7-6(5-2-1-3-5)11-10-4-9-7/h4-5H,1-3H2,(H2,8,9,10) |
| InChIKey | NKJGIQIHWOMSEG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |