C8H12N4 — CID 116823540
6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine (PubChem CID 116823540) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine.
| Compound Name | 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823540 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine |
| SMILES | Cc1nnc(C2CCC2)c(N)n1 |
| InChI | InChI=1S/C8H12N4/c1-5-10-8(9)7(12-11-5)6-3-2-4-6/h6H,2-4H2,1H3,(H2,9,10,11) |
| InChIKey | NBYFLBQYJOGSOM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |