About 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine
6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine (PubChem CID 116823540) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine.
Molecular Properties
| Compound Name | 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine |
| PubChem CID | 116823540 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine |
| SMILES | Cc1nnc(C2CCC2)c(N)n1 |
| InChI | InChI=1S/C8H12N4/c1-5-10-8(9)7(12-11-5)6-3-2-4-6/h6H,2-4H2,1H3,(H2,9,10,11) |
| InChIKey | NBYFLBQYJOGSOM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine?
The IUPAC name of 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine (CID 116823540) is 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine.
What is the SMILES notation for 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine?
The canonical SMILES for 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine is Cc1nnc(C2CCC2)c(N)n1.
What is the InChIKey of 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine?
The InChIKey is NBYFLBQYJOGSOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-5-10-8(9)7(12-11-5)6-3-2-4-6/h6H,2-4H2,1H3,(H2,9,10,11).
What are the key properties of 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine?
6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine has a molecular weight of 164.21 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclobutyl-3-methyl-1,2,4-triazin-5-amine is sourced from PubChem (CID 116823540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).