C18H23N3O2 — CID 90833965
6-cyclopentyl-5-(3,4-dimethoxyphenyl)-2-methylpyrimidin-4-amine (PubChem CID 90833965) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 6-cyclopentyl-5-(3,4-dimethoxyphenyl)-2-methylpyrimidin-4-amine.
| Compound Name | 6-cyclopentyl-5-(3,4-dimethoxyphenyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 90833965 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 6-cyclopentyl-5-(3,4-dimethoxyphenyl)-2-methylpyrimidin-4-amine |
| SMILES | COc1ccc(-c2c(N)nc(C)nc2C2CCCC2)cc1OC |
| InChI | InChI=1S/C18H23N3O2/c1-11-20-17(12-6-4-5-7-12)16(18(19)21-11)13-8-9-14(22-2)15(10-13)23-3/h8-10,12H,4-7H2,1-3H3,(H2,19,20,21) |
| InChIKey | HXVNEZZEDBLAJP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |