C17H18F3N3 — CID 91294249
6-cyclopentyl-5-(4-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 91294249) has the molecular formula C17H18F3N3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 6-cyclopentyl-5-(4-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-cyclopentyl-5-(4-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 91294249 |
| Molecular Formula | C17H18F3N3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 6-cyclopentyl-5-(4-methylphenyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2c(N)nc(C(F)(F)F)nc2C2CCCC2)cc1 |
| InChI | InChI=1S/C17H18F3N3/c1-10-6-8-11(9-7-10)13-14(12-4-2-3-5-12)22-16(17(18,19)20)23-15(13)21/h6-9,12H,2-5H2,1H3,(H2,21,22,23) |
| InChIKey | FBGBVPHQIXPQRS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |