C14H18N4O2 — CID 62483620
2-cyclopropyl-4-(3,4-dimethoxyphenyl)imidazole-1,5-diamine (PubChem CID 62483620) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-cyclopropyl-4-(3,4-dimethoxyphenyl)imidazole-1,5-diamine.
| Compound Name | 2-cyclopropyl-4-(3,4-dimethoxyphenyl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 62483620 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-cyclopropyl-4-(3,4-dimethoxyphenyl)imidazole-1,5-diamine |
| SMILES | COc1ccc(-c2nc(C3CC3)n(N)c2N)cc1OC |
| InChI | InChI=1S/C14H18N4O2/c1-19-10-6-5-9(7-11(10)20-2)12-13(15)18(16)14(17-12)8-3-4-8/h5-8H,3-4,15-16H2,1-2H3 |
| InChIKey | ADKYGMOJVNLTAI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |