C15H19ClN4O — CID 65022656
4-(3-chloro-4-methoxyphenyl)-2-cyclopentylimidazole-1,5-diamine (PubChem CID 65022656) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)-2-cyclopentylimidazole-1,5-diamine.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)-2-cyclopentylimidazole-1,5-diamine |
|---|---|
| PubChem CID | 65022656 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)-2-cyclopentylimidazole-1,5-diamine |
| SMILES | COc1ccc(-c2nc(C3CCCC3)n(N)c2N)cc1Cl |
| InChI | InChI=1S/C15H19ClN4O/c1-21-12-7-6-10(8-11(12)16)13-14(17)20(18)15(19-13)9-4-2-3-5-9/h6-9H,2-5,17-18H2,1H3 |
| InChIKey | QHFKWXPXNXDMJI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |