C14H16Cl2N4 — CID 62506110
2-cyclopentyl-4-(3,5-dichlorophenyl)imidazole-1,5-diamine (PubChem CID 62506110) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-cyclopentyl-4-(3,5-dichlorophenyl)imidazole-1,5-diamine.
| Compound Name | 2-cyclopentyl-4-(3,5-dichlorophenyl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 62506110 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-cyclopentyl-4-(3,5-dichlorophenyl)imidazole-1,5-diamine |
| SMILES | Nc1c(-c2cc(Cl)cc(Cl)c2)nc(C2CCCC2)n1N |
| InChI | InChI=1S/C14H16Cl2N4/c15-10-5-9(6-11(16)7-10)12-13(17)20(18)14(19-12)8-3-1-2-4-8/h5-8H,1-4,17-18H2 |
| InChIKey | MHTUJDJXKHNKIV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |