C9H12IN3 — CID 66305298
2-cyclobutyl-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 66305298) has the molecular formula C9H12IN3 and a molecular weight of 289.12 g/mol. Its IUPAC name is 2-cyclobutyl-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-cyclobutyl-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66305298 |
| Molecular Formula | C9H12IN3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-cyclobutyl-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(C2CCC2)nc(N)c1I |
| InChI | InChI=1S/C9H12IN3/c1-5-7(10)8(11)13-9(12-5)6-3-2-4-6/h6H,2-4H2,1H3,(H2,11,12,13) |
| InChIKey | YYRMTIGSAOWEJB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|