C8H10IN3 — CID 66307285
2-cyclopropyl-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 66307285) has the molecular formula C8H10IN3 and a molecular weight of 275.09 g/mol. Its IUPAC name is 2-cyclopropyl-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307285 |
| Molecular Formula | C8H10IN3 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 2-cyclopropyl-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(C2CC2)nc(N)c1I |
| InChI | InChI=1S/C8H10IN3/c1-4-6(9)7(10)12-8(11-4)5-2-3-5/h5H,2-3H2,1H3,(H2,10,11,12) |
| InChIKey | YIFQDMYSBMTJDE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|