C16H26IN3 — CID 66307233
6-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-iodopyrimidin-4-amine (PubChem CID 66307233) has the molecular formula C16H26IN3 and a molecular weight of 387.31 g/mol. Its IUPAC name is 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-iodopyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66307233 |
| Molecular Formula | C16H26IN3 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-5-iodopyrimidin-4-amine |
| SMILES | CC1(C)CCC(c2nc(N)c(I)c(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C16H26IN3/c1-15(2,3)12-11(17)13(18)20-14(19-12)10-6-8-16(4,5)9-7-10/h10H,6-9H2,1-5H3,(H2,18,19,20) |
| InChIKey | XCPQFRWAWCWMQW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|