C15H24IN3S — CID 66305037
6-tert-butyl-2-(cyclohexylsulfanylmethyl)-5-iodopyrimidin-4-amine (PubChem CID 66305037) has the molecular formula C15H24IN3S and a molecular weight of 405.35 g/mol. Its IUPAC name is 6-tert-butyl-2-(cyclohexylsulfanylmethyl)-5-iodopyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(cyclohexylsulfanylmethyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66305037 |
| Molecular Formula | C15H24IN3S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 6-tert-butyl-2-(cyclohexylsulfanylmethyl)-5-iodopyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(CSC2CCCCC2)nc(N)c1I |
| InChI | InChI=1S/C15H24IN3S/c1-15(2,3)13-12(16)14(17)19-11(18-13)9-20-10-7-5-4-6-8-10/h10H,4-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | MNTNQWLWBJVRIF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|