C14H22IN3S — CID 66299542
2-(cyclohexylsulfanylmethyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine (PubChem CID 66299542) has the molecular formula C14H22IN3S and a molecular weight of 391.32 g/mol. Its IUPAC name is 2-(cyclohexylsulfanylmethyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-(cyclohexylsulfanylmethyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299542 |
| Molecular Formula | C14H22IN3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-(cyclohexylsulfanylmethyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(CSC2CCCCC2)nc(N)c1I |
| InChI | InChI=1S/C14H22IN3S/c1-9(2)13-12(15)14(16)18-11(17-13)8-19-10-6-4-3-5-7-10/h9-10H,3-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | XUCGQXZFNMEGRY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|