C14H21ClN2S — CID 65139776
4-chloro-2-(cyclohexylsulfanylmethyl)-6-propan-2-ylpyrimidine (PubChem CID 65139776) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is 4-chloro-2-(cyclohexylsulfanylmethyl)-6-propan-2-ylpyrimidine.
| Compound Name | 4-chloro-2-(cyclohexylsulfanylmethyl)-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 65139776 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-chloro-2-(cyclohexylsulfanylmethyl)-6-propan-2-ylpyrimidine |
| SMILES | CC(C)c1cc(Cl)nc(CSC2CCCCC2)n1 |
| InChI | InChI=1S/C14H21ClN2S/c1-10(2)12-8-13(15)17-14(16-12)9-18-11-6-4-3-5-7-11/h8,10-11H,3-7,9H2,1-2H3 |
| InChIKey | VJLWPLFNLPCTOO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |