C9H14ClN3S — CID 79600542
5-(chloromethyl)-3-(cyclopentylsulfanylmethyl)-1H-1,2,4-triazole (PubChem CID 79600542) has the molecular formula C9H14ClN3S and a molecular weight of 231.75 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(cyclopentylsulfanylmethyl)-1H-1,2,4-triazole.
| Compound Name | 5-(chloromethyl)-3-(cyclopentylsulfanylmethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 79600542 |
| Molecular Formula | C9H14ClN3S |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-(chloromethyl)-3-(cyclopentylsulfanylmethyl)-1H-1,2,4-triazole |
| SMILES | ClCc1nc(CSC2CCCC2)n[nH]1 |
| InChI | InChI=1S/C9H14ClN3S/c10-5-8-11-9(13-12-8)6-14-7-3-1-2-4-7/h7H,1-6H2,(H,11,12,13) |
| InChIKey | RSIFGALUAGJMEX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|