C14H23NS3 — CID 82434438
[2-(cyclohexylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol (PubChem CID 82434438) has the molecular formula C14H23NS3 and a molecular weight of 301.55 g/mol. Its IUPAC name is [2-(cyclohexylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-(cyclohexylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82434438 |
| Molecular Formula | C14H23NS3 |
| Molecular Weight | 301.55 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [2-(cyclohexylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methanethiol |
| SMILES | CC(C)c1nc(CSC2CCCCC2)sc1CS |
| InChI | InChI=1S/C14H23NS3/c1-10(2)14-12(8-16)18-13(15-14)9-17-11-6-4-3-5-7-11/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | YJAAWSMJJYOUIJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|