C16H18BrN3S — CID 66293704
5-bromo-2-(cyclopentylsulfanylmethyl)-6-phenylpyrimidin-4-amine (PubChem CID 66293704) has the molecular formula C16H18BrN3S and a molecular weight of 364.31 g/mol. Its IUPAC name is 5-bromo-2-(cyclopentylsulfanylmethyl)-6-phenylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(cyclopentylsulfanylmethyl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66293704 |
| Molecular Formula | C16H18BrN3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 5-bromo-2-(cyclopentylsulfanylmethyl)-6-phenylpyrimidin-4-amine |
| SMILES | Nc1nc(CSC2CCCC2)nc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C16H18BrN3S/c17-14-15(11-6-2-1-3-7-11)19-13(20-16(14)18)10-21-12-8-4-5-9-12/h1-3,6-7,12H,4-5,8-10H2,(H2,18,19,20) |
| InChIKey | KJZYAMCFXMWBEO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |