C14H16IN3S — CID 66294126
5-iodo-6-phenyl-2-(propan-2-ylsulfanylmethyl)pyrimidin-4-amine (PubChem CID 66294126) has the molecular formula C14H16IN3S and a molecular weight of 385.27 g/mol. Its IUPAC name is 5-iodo-6-phenyl-2-(propan-2-ylsulfanylmethyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-6-phenyl-2-(propan-2-ylsulfanylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66294126 |
| Molecular Formula | C14H16IN3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 5-iodo-6-phenyl-2-(propan-2-ylsulfanylmethyl)pyrimidin-4-amine |
| SMILES | CC(C)SCc1nc(N)c(I)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H16IN3S/c1-9(2)19-8-11-17-13(12(15)14(16)18-11)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H2,16,17,18) |
| InChIKey | ZVLPRJYLMSSYJJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|