C13H11F3IN3O — CID 103476247
5-iodo-6-phenyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine (PubChem CID 103476247) has the molecular formula C13H11F3IN3O and a molecular weight of 409.15 g/mol. Its IUPAC name is 5-iodo-6-phenyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-6-phenyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103476247 |
| Molecular Formula | C13H11F3IN3O |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 5-iodo-6-phenyl-2-(2,2,2-trifluoroethoxymethyl)pyrimidin-4-amine |
| SMILES | Nc1nc(COCC(F)(F)F)nc(-c2ccccc2)c1I |
| InChI | InChI=1S/C13H11F3IN3O/c14-13(15,16)7-21-6-9-19-11(10(17)12(18)20-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,18,19,20) |
| InChIKey | BONBWKAGGZOPMN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|