About 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine
5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine (PubChem CID 104846675) has the molecular formula C14H14F3N3
and a molecular weight of 281.28 g/mol. Its IUPAC name is 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| PubChem CID | 104846675 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| SMILES | Cc1c(N)nc(CCC(F)(F)F)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H14F3N3/c1-9-12(10-5-3-2-4-6-10)19-11(20-13(9)18)7-8-14(15,16)17/h2-6H,7-8H2,1H3,(H2,18,19,20) |
| InChIKey | IZLCPRMAVCPEHD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine?
The IUPAC name of 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine (CID 104846675) is 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
What is the SMILES notation for 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine?
The canonical SMILES for 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine is Cc1c(N)nc(CCC(F)(F)F)nc1-c1ccccc1.
What is the InChIKey of 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine?
The InChIKey is IZLCPRMAVCPEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3/c1-9-12(10-5-3-2-4-6-10)19-11(20-13(9)18)7-8-14(15,16)17/h2-6H,7-8H2,1H3,(H2,18,19,20).
What are the key properties of 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine?
5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine has a molecular weight of 281.28 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine is sourced from PubChem (CID 104846675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).