C14H14F3N3 — CID 104846675
5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine (PubChem CID 104846675) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
| Compound Name | 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104846675 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-methyl-6-phenyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| SMILES | Cc1c(N)nc(CCC(F)(F)F)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H14F3N3/c1-9-12(10-5-3-2-4-6-10)19-11(20-13(9)18)7-8-14(15,16)17/h2-6H,7-8H2,1H3,(H2,18,19,20) |
| InChIKey | IZLCPRMAVCPEHD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |