C15H16F3N3 — CID 80978112
5-methyl-2-propyl-6-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 80978112) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is 5-methyl-2-propyl-6-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-methyl-2-propyl-6-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80978112 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-methyl-2-propyl-6-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CCCc1nc(N)c(C)c(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C15H16F3N3/c1-3-6-12-20-13(9(2)14(19)21-12)10-7-4-5-8-11(10)15(16,17)18/h4-5,7-8H,3,6H2,1-2H3,(H2,19,20,21) |
| InChIKey | YFPDJWQFWPMKHS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |