C14H14F3N3O — CID 80988712
2-ethyl-5-methyl-6-[2-(trifluoromethyl)phenoxy]pyrimidin-4-amine (PubChem CID 80988712) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-ethyl-5-methyl-6-[2-(trifluoromethyl)phenoxy]pyrimidin-4-amine.
| Compound Name | 2-ethyl-5-methyl-6-[2-(trifluoromethyl)phenoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80988712 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-ethyl-5-methyl-6-[2-(trifluoromethyl)phenoxy]pyrimidin-4-amine |
| SMILES | CCc1nc(N)c(C)c(Oc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H14F3N3O/c1-3-11-19-12(18)8(2)13(20-11)21-10-7-5-4-6-9(10)14(15,16)17/h4-7H,3H2,1-2H3,(H2,18,19,20) |
| InChIKey | UVHZXBSMBZOREI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |