C10H8ClN3O — CID 116823799
5-chloro-3-(2-methoxyphenyl)-1,2,4-triazine (PubChem CID 116823799) has the molecular formula C10H8ClN3O and a molecular weight of 221.65 g/mol. Its IUPAC name is 5-chloro-3-(2-methoxyphenyl)-1,2,4-triazine.
| Compound Name | 5-chloro-3-(2-methoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 116823799 |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 5-chloro-3-(2-methoxyphenyl)-1,2,4-triazine |
| SMILES | COc1ccccc1-c1nncc(Cl)n1 |
| InChI | InChI=1S/C10H8ClN3O/c1-15-8-5-3-2-4-7(8)10-13-9(11)6-12-14-10/h2-6H,1H3 |
| InChIKey | BFPLCVXEYSTQAB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |