C10H8ClNOS — CID 83911216
3-chloro-5-(2-methoxyphenyl)-1,2-thiazole (PubChem CID 83911216) has the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. Its IUPAC name is 3-chloro-5-(2-methoxyphenyl)-1,2-thiazole.
| Compound Name | 3-chloro-5-(2-methoxyphenyl)-1,2-thiazole |
|---|---|
| PubChem CID | 83911216 |
| Molecular Formula | C10H8ClNOS |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 3-chloro-5-(2-methoxyphenyl)-1,2-thiazole |
| SMILES | COc1ccccc1-c1cc(Cl)ns1 |
| InChI | InChI=1S/C10H8ClNOS/c1-13-8-5-3-2-4-7(8)9-6-10(11)12-14-9/h2-6H,1H3 |
| InChIKey | RATOEYMMQMMLQD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |