C13H8ClN3 — CID 116823814
5-chloro-3-naphthalen-1-yl-1,2,4-triazine (PubChem CID 116823814) has the molecular formula C13H8ClN3 and a molecular weight of 241.68 g/mol. Its IUPAC name is 5-chloro-3-naphthalen-1-yl-1,2,4-triazine.
| Compound Name | 5-chloro-3-naphthalen-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 116823814 |
| Molecular Formula | C13H8ClN3 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-chloro-3-naphthalen-1-yl-1,2,4-triazine |
| SMILES | Clc1cnnc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C13H8ClN3/c14-12-8-15-17-13(16-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-8H |
| InChIKey | JRERCVPAZXLUPK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |