C11H12BrN3 — CID 116827020
3-(2-bromophenyl)-N,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 116827020) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N,5-dimethyl-1H-pyrazol-4-amine.
| Compound Name | 3-(2-bromophenyl)-N,5-dimethyl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 116827020 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 3-(2-bromophenyl)-N,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | CNc1c(-c2ccccc2Br)n[nH]c1C |
| InChI | InChI=1S/C11H12BrN3/c1-7-10(13-2)11(15-14-7)8-5-3-4-6-9(8)12/h3-6,13H,1-2H3,(H,14,15) |
| InChIKey | SPTFCJXYQBSHIJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |