C11H19N3 — CID 116827500
5-cyclohexyl-N,1-dimethylpyrazol-3-amine (PubChem CID 116827500) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-cyclohexyl-N,1-dimethylpyrazol-3-amine.
| Compound Name | 5-cyclohexyl-N,1-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 116827500 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-cyclohexyl-N,1-dimethylpyrazol-3-amine |
| SMILES | CNc1cc(C2CCCCC2)n(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-12-11-8-10(14(2)13-11)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | YXKGAVJCMYNTQE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |