C17H11N3O3S3 — CID 11682794
N-[(5Z)-5-[(4-cyanophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 11682794) has the molecular formula C17H11N3O3S3 and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[(5Z)-5-[(4-cyanophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[(5Z)-5-[(4-cyanophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11682794 |
| Molecular Formula | C17H11N3O3S3 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-[(5Z)-5-[(4-cyanophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(/C=C2\SC(=S)N(NS(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C17H11N3O3S3/c18-11-13-8-6-12(7-9-13)10-15-16(21)20(17(24)25-15)19-26(22,23)14-4-2-1-3-5-14/h1-10,19H/b15-10- |
| InChIKey | YRYISTFZHCUCJS-GDNBJRDFSA-N |
| XLogP | 2.65 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|