C11H7N3OS2 — CID 11529046
4-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile (PubChem CID 11529046) has the molecular formula C11H7N3OS2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile.
| Compound Name | 4-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile |
|---|---|
| PubChem CID | 11529046 |
| Molecular Formula | C11H7N3OS2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-[(Z)-(3-amino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C2\SC(=S)N(N)C2=O)cc1 |
| InChI | InChI=1S/C11H7N3OS2/c12-6-8-3-1-7(2-4-8)5-9-10(15)14(13)11(16)17-9/h1-5H,13H2/b9-5- |
| InChIKey | NLPPSTKAYIYYEI-UITAMQMPSA-N |
| XLogP | 1.63 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|