1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid

C16H19NO2 — CID 116828679

IUPAC1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid
SMILESCc1ccc(-c2cc(C(=O)O)c(C)n2C)c(C)c1C
InChIInChI=1S/C16H19NO2/c1-9-6-7-13(11(3)10(9)2)15-8-14(16(18)19)12(4)17(15)5/h6-8H,1-5H3,(H,18,19)
InChIKeyKLGIXFSFIBJHGU-UHFFFAOYSA-N
MW257.33 g/mol
LogP3.62
Rot. Bonds2

About 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid

1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid (PubChem CID 116828679) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid.

Molecular Properties

Compound Name1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid
PubChem CID116828679
Molecular FormulaC16H19NO2
Molecular Weight257.33 g/mol
Exact Mass257.14
IUPAC Name1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid
SMILESCc1ccc(-c2cc(C(=O)O)c(C)n2C)c(C)c1C
InChIInChI=1S/C16H19NO2/c1-9-6-7-13(11(3)10(9)2)15-8-14(16(18)19)12(4)17(15)5/h6-8H,1-5H3,(H,18,19)
InChIKeyKLGIXFSFIBJHGU-UHFFFAOYSA-N
XLogP3.62
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 53.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid?
The IUPAC name of 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid (CID 116828679) is 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid.
What is the SMILES notation for 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid?
The canonical SMILES for 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid is Cc1ccc(-c2cc(C(=O)O)c(C)n2C)c(C)c1C.
What is the InChIKey of 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid?
The InChIKey is KLGIXFSFIBJHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-9-6-7-13(11(3)10(9)2)15-8-14(16(18)19)12(4)17(15)5/h6-8H,1-5H3,(H,18,19).
What are the key properties of 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid?
1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid has a molecular weight of 257.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5-(2,3,4-trimethylphenyl)pyrrole-3-carboxylic acid is sourced from PubChem (CID 116828679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).