1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid

C13H13NO3 — CID 82184260

IUPAC1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid
SMILESCc1cc2c(C(=O)O)cc(=O)n(C)c2cc1C
InChIInChI=1S/C13H13NO3/c1-7-4-9-10(13(16)17)6-12(15)14(3)11(9)5-8(7)2/h4-6H,1-3H3,(H,16,17)
InChIKeyCDMKKTJQJXIGLI-UHFFFAOYSA-N
MW231.25 g/mol
LogP1.85
Rot. Bonds1

About 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid

1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid (PubChem CID 82184260) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid.

Molecular Properties

Compound Name1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid
PubChem CID82184260
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid
SMILESCc1cc2c(C(=O)O)cc(=O)n(C)c2cc1C
InChIInChI=1S/C13H13NO3/c1-7-4-9-10(13(16)17)6-12(15)14(3)11(9)5-8(7)2/h4-6H,1-3H3,(H,16,17)
InChIKeyCDMKKTJQJXIGLI-UHFFFAOYSA-N
XLogP1.85
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid?
The IUPAC name of 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid (CID 82184260) is 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid.
What is the SMILES notation for 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid?
The canonical SMILES for 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid is Cc1cc2c(C(=O)O)cc(=O)n(C)c2cc1C.
What is the InChIKey of 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid?
The InChIKey is CDMKKTJQJXIGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-7-4-9-10(13(16)17)6-12(15)14(3)11(9)5-8(7)2/h4-6H,1-3H3,(H,16,17).
What are the key properties of 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid?
1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid has a molecular weight of 231.25 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6,7-trimethyl-2-oxoquinoline-4-carboxylic acid is sourced from PubChem (CID 82184260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).