C12H15FN2O3 — CID 116829356
3-(5-fluoro-2-methoxyphenyl)piperazine-2-carboxylic acid (PubChem CID 116829356) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxyphenyl)piperazine-2-carboxylic acid.
| Compound Name | 3-(5-fluoro-2-methoxyphenyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 116829356 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-(5-fluoro-2-methoxyphenyl)piperazine-2-carboxylic acid |
| SMILES | COc1ccc(F)cc1C1NCCNC1C(=O)O |
| InChI | InChI=1S/C12H15FN2O3/c1-18-9-3-2-7(13)6-8(9)10-11(12(16)17)15-5-4-14-10/h2-3,6,10-11,14-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | XPGTYJZQYKWWJA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |