C9H10N2O2S — CID 116830041
5-(1-hydroxy-2-sulfanylethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 116830041) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-(1-hydroxy-2-sulfanylethyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(1-hydroxy-2-sulfanylethyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 116830041 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-(1-hydroxy-2-sulfanylethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(O)CS)cc2[nH]1 |
| InChI | InChI=1S/C9H10N2O2S/c12-8(4-14)5-1-2-6-7(3-5)11-9(13)10-6/h1-3,8,12,14H,4H2,(H2,10,11,13) |
| InChIKey | HVASCVFCOGONLI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|