C26H26N2O3 — CID 11683079
(E)-3-[4-[3-[methyl-[(4-propylphenyl)carbamoyl]amino]phenyl]phenyl]prop-2-enoic acid (PubChem CID 11683079) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (E)-3-[4-[3-[methyl-[(4-propylphenyl)carbamoyl]amino]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-[methyl-[(4-propylphenyl)carbamoyl]amino]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11683079 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (E)-3-[4-[3-[methyl-[(4-propylphenyl)carbamoyl]amino]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCc1ccc(NC(=O)N(C)c2cccc(-c3ccc(/C=C/C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-3-5-19-10-15-23(16-11-19)27-26(31)28(2)24-7-4-6-22(18-24)21-13-8-20(9-14-21)12-17-25(29)30/h4,6-18H,3,5H2,1-2H3,(H,27,31)(H,29,30)/b17-12+ |
| InChIKey | NMXXENAPDOOKSZ-SFQUDFHCSA-N |
| XLogP | 6.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|