C14H18N2O — CID 116832613
N,5-dimethyl-4-(2,4,5-trimethylphenyl)-1,3-oxazol-2-amine (PubChem CID 116832613) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N,5-dimethyl-4-(2,4,5-trimethylphenyl)-1,3-oxazol-2-amine.
| Compound Name | N,5-dimethyl-4-(2,4,5-trimethylphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116832613 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N,5-dimethyl-4-(2,4,5-trimethylphenyl)-1,3-oxazol-2-amine |
| SMILES | CNc1nc(-c2cc(C)c(C)cc2C)c(C)o1 |
| InChI | InChI=1S/C14H18N2O/c1-8-6-10(3)12(7-9(8)2)13-11(4)17-14(15-5)16-13/h6-7H,1-5H3,(H,15,16) |
| InChIKey | JZRKEXXVNKEFQK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |