C14H18N2O — CID 116831805
5-methyl-4-(2,3,5,6-tetramethylphenyl)-1,3-oxazol-2-amine (PubChem CID 116831805) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-methyl-4-(2,3,5,6-tetramethylphenyl)-1,3-oxazol-2-amine.
| Compound Name | 5-methyl-4-(2,3,5,6-tetramethylphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116831805 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 5-methyl-4-(2,3,5,6-tetramethylphenyl)-1,3-oxazol-2-amine |
| SMILES | Cc1cc(C)c(C)c(-c2nc(N)oc2C)c1C |
| InChI | InChI=1S/C14H18N2O/c1-7-6-8(2)10(4)12(9(7)3)13-11(5)17-14(15)16-13/h6H,1-5H3,(H2,15,16) |
| InChIKey | FUJAFGFGGPFHHS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |