C14H12N2O3 — CID 116832872
1-(6-methyl-1,3-benzodioxol-5-yl)-2-pyrimidin-4-ylethanone (PubChem CID 116832872) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-(6-methyl-1,3-benzodioxol-5-yl)-2-pyrimidin-4-ylethanone.
| Compound Name | 1-(6-methyl-1,3-benzodioxol-5-yl)-2-pyrimidin-4-ylethanone |
|---|---|
| PubChem CID | 116832872 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-(6-methyl-1,3-benzodioxol-5-yl)-2-pyrimidin-4-ylethanone |
| SMILES | Cc1cc2c(cc1C(=O)Cc1ccncn1)OCO2 |
| InChI | InChI=1S/C14H12N2O3/c1-9-4-13-14(19-8-18-13)6-11(9)12(17)5-10-2-3-15-7-16-10/h2-4,6-7H,5,8H2,1H3 |
| InChIKey | CSDKXZSYXZDESV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |